 |
|
Your location>> Home>>Products |
 |
N-Bromosuccinimide |
| product name: |
N-Bromosuccinimide |
| CAS NO: |
128-08-05 |
| Molecular weight: |
177.9841 |
| EC NO: |
204-877-2 |
| Formula: |
C4H4BrNO2 |
| InChI： |
InChI=1/C4H4BrNO2/c5-6-3(7)1-2-4(6)8/h1-2H2 |
| Specification: |
More than 99% |
| package: |
25 kg drum |
| Product description: |
Colorless to white crystals
Content of 99%
Melting point 173-183 (℃)
Loss on drying ≤1
Maximum sulfur content of 0.2%
Up to 0.02% free acid |
| Use: |
Primarily as brominated organic reaction treatment agent, it is also used in conventional organic synthesis. |
| Alias: |
N- bromosuccinimide; N- bromo succinamide; bromosuccinimide; bromosuccinimide; NBS; N- bromosuccinimide |
| Structure: |
 |
| Appearance: |
White or light yellow crystal |
| Content: |
≥99％ |
| Effective bromine: |
＞44％ |
| Melting point: |
173-183℃ |
| Water solubility test: |
Dissolved in water |
| Acid dissolution test: |
Meets the requirements |
| Chloride: |
≤1.0％ |
| Loss on drying: |
≤0.5％ |
|
|
|
